For research use only. Not for therapeutic Use.
Diethyl carbonate（Cat No.:R018481）, is an organic compound that serves various industrial and chemical purposes. It is a clear, colorless liquid with a fruity odor and is commonly used as a solvent in chemical processes, particularly in the production of pharmaceuticals, perfumes, and plastics. Diethyl carbonate also has applications as an electrolyte component in lithium-ion batteries and as a reactant in the synthesis of organic compounds.
| Catalog Number | R018481 |
| CAS Number | 105-58-8 |
| Synonyms | DEC; Diatol; Diatol (Carbonate); Diethyl Carbonate; Diethyl Ester Carbonic Acid; Ethyl Carbonate; Ethyl Carbonate ((EtO)2CO); Eufin; H-DEC; NSC 8849; |
| Molecular Formula | C5H10O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | diethyl carbonate |
| InChI | InChI=1S/C5H10O3/c1-3-7-5(6)8-4-2/h3-4H2,1-2H3 |
| InChIKey | OIFBSDVPJOWBCH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)OCC |
