For research use only. Not for therapeutic Use.
Diethyl Phosphite (Cat.No:R022605) is a chemical compound commonly used in organic synthesis as a versatile reagent. It serves as a source of phosphorus in reactions and is employed in the manufacture of various organophosphorus compounds. Additionally, it finds applications in the production of agrochemicals, flame retardants, and pharmaceuticals.
| Catalog Number | R022605 |
| CAS Number | 762-04-9 |
| Synonyms | Phosphonic Acid Diethyl Ester; Ethyl phosphite (EtO)2(HO)P; Diethoxyphosphine Oxide; Diethyl Acid Phosphite; Diethyl Hydrogen Phosphite; Diethyl phosphonate; Hydrogen Diethyl Phosphite; NSC 2665; ? |
| Molecular Formula | C4H10O3P+ |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | diethoxy(oxo)phosphanium |
| InChI | InChI=1S/C4H10O3P/c1-3-6-8(5)7-4-2/h3-4H2,1-2H3/q+1 |
| InChIKey | LXCYSACZTOKNNS-UHFFFAOYSA-N |
| SMILES | CCO[P+](=O)OCC |
