For research use only. Not for therapeutic Use.
Diethyl succinate is an ester derived from succinic acid and ethanol, commonly used as a solvent and intermediate in organic synthesis. Its applications include the production of pharmaceuticals, agrochemicals, and polymers. Additionally, diethyl succinate serves as a flavoring agent and plasticizer. Its versatility and relatively low toxicity make it valuable in various chemical manufacturing processes.
CAS Number | 123-25-1 |
Synonyms | Butanedioic Acid Diethyl Ester; Succinic Acid Diethyl Ester;?1,4-Diethyl Butanedioate; Butandioic Acid Diethyl Ester; Clorius; DESU; Diethyl Butanedioate; Diethyl succinate; Ethyl succinate; NSC 8875 |
Molecular Formula | C8H14O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | diethyl butanedioate |
InChI | InChI=1S/C8H14O4/c1-3-11-7(9)5-6-8(10)12-4-2/h3-6H2,1-2H3 |
InChIKey | DKMROQRQHGEIOW-UHFFFAOYSA-N |
SMILES | CCOC(=O)CCC(=O)OCC |