For research use only. Not for therapeutic Use.
Diethylene Glycol-d8(Cat No.:R018579) is a high-purity deuterated compound featuring eight deuterium atoms, essential for advanced chemical, pharmaceutical, and environmental research. This isotopically labeled version of diethylene glycol is crucial for studies involving metabolic pathways, reaction mechanisms, and toxicological analysis. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the robustness of experimental data. Ideal for use in NMR spectroscopy, mass spectrometry, and tracer studies, Diethylene Glycol-d8 integrates seamlessly into existing protocols, offering a dependable and cost-effective solution for high-precision scientific investigations across various research fields.
CAS Number | 102867-56-1 |
Synonyms | 1,5-Dihydroxy-3-oxapentane-d8; 2-Hydroxyethoxyethanol-d8; 3-Oxapentamethylene-1,5-diol-d8; 3-Oxapentane-1,5-diol-d8; Ethylene Diglycol-d8; NSC 36391-d8 |
Molecular Formula | C4H10O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,1,2,2-tetradeuterio-2-(1,1,2,2-tetradeuterio-2-hydroxyethoxy)ethanol |
InChI | InChI=1S/C4H10O3/c5-1-3-7-4-2-6/h5-6H,1-4H2/i1D2,2D2,3D2,4D2 |
InChIKey | MTHSVFCYNBDYFN-SVYQBANQSA-N |
SMILES | [2H]C([2H])(C([2H])([2H])OC([2H])([2H])C([2H])([2H])O)O |