For research use only. Not for therapeutic Use.
Diethylene glycol mono-methacrylate(Cat No.:M018879) is a chemical compound used primarily as a monomer in the production of polymers and copolymers. It belongs to the acrylate family, characterized by the presence of a methacrylate group that allows for effective polymerization. The diethylene glycol portion of the molecule acts as a flexible spacer, imparting elasticity and enhancing the hydrophilic properties of the resulting polymers. These features make it particularly useful in applications requiring durable, flexible, and moisture-resistant materials, such as coatings, adhesives, sealants, and composite materials in various industrial settings.
Catalog Number | M018879 |
CAS Number | 2351-43-1 |
Synonyms | DIETHYLENE GLYCOL MONO-METHACRYLATE;2-Propenoic acid, 2-methyl-, 2-(2-hydroxyethoxy)ethyl ester |
Molecular Formula | C8H14O4 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2-methylprop-2-enoate |
InChI | InChI=1S/C8H14O4/c1-7(2)8(10)12-6-5-11-4-3-9/h9H,1,3-6H2,2H3 |
InChIKey | OLQFXOWPTQTLDP-UHFFFAOYSA-N |
SMILES | CC(=C)C(=O)OCCOCCO |