For research use only. Not for therapeutic Use.
Difloxacin-d3 hydrochloride（Cat No.:I043736）is a stable isotope-labeled form of difloxacin, a broad-spectrum fluoroquinolone antibiotic. The “d3” indicates that the molecule contains three deuterium atoms, which are heavier isotopes of hydrogen. This modification makes difloxacin-d3 useful in pharmacokinetic and metabolic studies, as it allows researchers to track the drug’s absorption, distribution, metabolism, and excretion (ADME) in biological systems using mass spectrometry. Difloxacin is commonly used to treat bacterial infections, and its labeled counterpart aids in studying its pharmacological properties and evaluating its interactions in clinical research and drug development.
| CAS Number | 1173021-89-0 |
| Synonyms | 6-fluoro-1-(4-fluorophenyl)-4-oxo-7-[4-(trideuteriomethyl)piperazin-1-yl]quinoline-3-carboxylic acid;hydrochloride |
| Molecular Formula | C21H17D3ClF2N3O3 |
| Purity | ≥95% |
| IUPAC Name | 6-fluoro-1-(4-fluorophenyl)-4-oxo-7-[4-(trideuteriomethyl)piperazin-1-yl]quinoline-3-carboxylic acid;hydrochloride |
| InChI | InChI=1S/C21H19F2N3O3.ClH/c1-24-6-8-25(9-7-24)19-11-18-15(10-17(19)23)20(27)16(21(28)29)12-26(18)14-4-2-13(22)3-5-14;/h2-5,10-12H,6-9H2,1H3,(H,28,29);1H/i1D3; |
| InChIKey | JFMGBGLSDVIOHL-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4=CC=C(C=C4)F)F.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
