For research use only. Not for therapeutic Use.
Digoxigenin (CAT: I002184) is a small molecule derived from the plant Digitalis purpurea, commonly known as foxglove. It is widely used in molecular biology and biochemistry as a probe for the detection and localization of nucleic acids. Digoxigenin is often conjugated to nucleotides or antibodies to facilitate its binding to specific target molecules. In nucleic acid research, digoxigenin-labeled probes are used for techniques such as in situ hybridization, Southern blotting, and Northern blotting to visualize and study the presence and expression of specific genes. The binding of digoxigenin to target molecules can be detected using immunological methods, such as enzyme-linked immunosorbent assays (ELISAs) or immunohistochemistry.
| Catalog Number | I002184 |
| CAS Number | 1672-46-4 |
| Synonyms | Digoxigenin; Lanadigenin |
| Molecular Formula | C23H34O5 |
| Purity | ≥95% |
| Target | Immunology and Inflammatory Disease Models |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20C powder |
| InChI | InChI=1S/C23H34O5/c1-21-7-5-15(24)10-14(21)3-4-17-18(21)11-19(25)22(2)16(6-8-23(17,22)27)13-9-20(26)28-12-13/h9,14-19,24-25,27H,3-8,10-12H2,1-2H3/t14-,15+,16-,17-,18+,19-,21+,22+,23+/m1/s1 |
| InChIKey | SHIBSTMRCDJXLN-KCZCNTNESA-N |
| SMILES | CC12CCC(CC1CCC3C2CC(C4(C3(CCC4C5=CC(=O)OC5)O)C)O)O |
| Reference | 1: Baumgart E, Schad A, Völkl A, Fahimi HD. Detection of mRNAs encoding <br> <br> |
