For research use only. Not for therapeutic Use.
Diheptyltin Dichloride (Cat No.:C000962) is an organotin compound. It is a clear to pale yellow liquid that serves as a catalyst and stabilizer in various industrial processes, particularly in the production of polyurethane foams and elastomers. This compound acts as a tin-based catalyst and aids in the formation of urethane linkages during polymerization reactions. Additionally, it finds use in the synthesis of specialty chemicals.
CAS Number | 74340-12-8 |
Synonyms | Dichlorodiheptylstannane; |
Molecular Formula | C₁₄H₃₀Cl₂Sn |
Purity | ≥95% |
Solubility | Chloroform (Slightly) |
Appearance | White to Off-White Low-Melting Solid |
Storage | 4°C, Hygroscopic |
IUPAC Name | dichloro(diheptyl)stannane |
InChI | InChI=1S/2C7H15.2ClH.Sn/c2*1-3-5-7-6-4-2;;;/h2*1,3-7H2,2H3;2*1H;/q;;;;+2/p-2 |
InChIKey | IPTFHACHRGARHN-UHFFFAOYSA-L |
SMILES | CCCCCCC[Sn](CCCCCCC)(Cl)Cl |
Reference | Papaspyrou, S. et al: Appl. Organometal. Chem., 21, 412 (2007) |