Dihexa（Cat No.:R029524）is a small peptide compound known for its potent neurogenic and cognitive-enhancing properties. Derived from angiotensin IV, Dihexa crosses the blood-brain barrier and promotes synaptogenesis, making it a promising candidate for treating neurodegenerative diseases such as Alzheimer’s and Parkinson’s. It binds to hepatocyte growth factor (HGF) and c-Met receptor, stimulating neuronal growth and repair. Research indicates that Dihexa may improve learning, memory, and cognitive functions. Its potential to regenerate brain cells and enhance neural connections positions it as a valuable therapeutic agent in neurological and cognitive health.
| Catalog Number | R029524 |
| CAS Number | 1401708-83-5 |
| Synonyms | N-(1-Oxohexyl)-L-tyrosyl-N-(6-amino-6-oxohexyl)-L-isoleucinamide |
| Molecular Formula | C27 H44 N4 O5 |
| Purity | ≥95% |
| Storage | Desiccate at +4C |
| IUPAC Name | (2S,3S)-N-(6-amino-6-oxohexyl)-2-[[(2S)-2-(hexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanamide |
| InChI | InChI=1S/C27H44N4O5/c1-4-6-8-12-24(34)30-22(18-20-13-15-21(32)16-14-20)26(35)31-25(19(3)5-2)27(36)29-17-10-7-9-11-23(28)33/h13-16,19,22,25,32H,4-12,17-18H2,1-3H3,(H2,28,33)(H,29,36)(H,30,34)(H,31,35)/t19-,22-,25-/m0/s1 |
| InChIKey | XEUVNVNAVKZSPT-JTJYXVOQSA-N |
| SMILES | CCCCCC(=O)NC(CC1=CC=C(C=C1)O)C(=O)NC(C(C)CC)C(=O)NCCCCCC(=O)N |
