For research use only. Not for therapeutic Use.
Dihexylphthalate-D4 (Cat No.:C000831) is a deuterium-labeled variant of dihexyl phthalate, a phthalate ester commonly used as a plasticizer in various industrial applications. The “D4” notation indicates that four hydrogen atoms in the molecule are replaced with deuterium, a stable isotope of hydrogen. This labeling allows for precise isotope tracking and tracing in research and analytical applications. Dihexylphthalate-D4 is utilized in environmental monitoring studies to identify and quantify the parent compound and its metabolites in complex matrices, contributing to the assessment of phthalate exposure and potential environmental risks.
| Catalog Number | C000831 |
| CAS Number | 1015854-55-3 |
| Synonyms | Dihexylphthalate, Branched And Linear-D4; |
| Molecular Formula | C₂₀H₂₆D₄O₄ |
| Purity | ≥95% |
| Solubility | Acetone (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| Appearance | Colourless Oil |
| Storage | 4°C |
| IUPAC Name | dihexyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChI | InChI=1S/C20H30O4/c1-3-5-7-11-15-23-19(21)17-13-9-10-14-18(17)20(22)24-16-12-8-6-4-2/h9-10,13-14H,3-8,11-12,15-16H2,1-2H3/i9D,10D,13D,14D |
| InChIKey | KCXZNSGUUQJJTR-LSQQNFJSSA-N |
| SMILES | CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCC |
| Reference | Saido, K., et al.: J. Am. Oil Chem. Soc 61, 945 (1984); Foghmoes, S., et al.: J. Eur. Ceram. Soc. 36, 3441 (2016); Przybylińska, P. A. and Wyszkowski, M.: Ecol. Chem. Eng., S 23,347 (2016) |
