For research use only. Not for therapeutic Use.
Dihydro-5-methyl-5-vinylfuran-2(3H)-one(Cat No.:M069180)is an organic compound featuring a furan ring with a methyl group and a vinyl group attached to the 5-position. Known for its versatile reactivity, this compound is used as an intermediate in the synthesis of various chemicals, including pharmaceuticals and agrochemicals. Its unique structure, combining a saturated furan ring with reactive functional groups, makes it valuable for constructing complex molecular architectures. This compound is often employed in the development of bioactive compounds and specialty materials, supporting research in medicinal chemistry and materials science.
CAS Number | 1073-11-6 |
Molecular Formula | C7H10O2 |
Purity | ≥95% |
IUPAC Name | 5-ethenyl-5-methyloxolan-2-one |
InChI | InChI=1S/C7H10O2/c1-3-7(2)5-4-6(8)9-7/h3H,1,4-5H2,2H3 |
InChIKey | QESPSAHXYXIGBG-UHFFFAOYSA-N |
SMILES | CC1(CCC(=O)O1)C=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |