For research use only. Not for therapeutic Use.
Dihydro Capsaicin is a naturally occurring capsaicinoid derived from chili peppers, structurally similar to capsaicin but with reduced pungency. It activates the TRPV1 (transient receptor potential vanilloid 1) ion channel, leading to calcium influx and desensitization of pain receptors. Dihydro Capsaicin is widely studied for its analgesic, anti-inflammatory, and metabolic effects, including its role in enhancing energy expenditure and lipid metabolism. Its potential in pain management, obesity, and cardiovascular research makes it a valuable compound for investigating sensory neuron function and therapeutic applications.
CAS Number | 19408-84-5 |
Synonyms | N-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methylnonanamide; 8-Methyl-N-vanillylnonanamide; 6,7-Dihydrocapsaicin; Dihydrocapsaicin; |
Molecular Formula | C18H29NO3 |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | -20°C |
IUPAC Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methylnonanamide |
InChI | InChI=1S/C18H29NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h10-12,14,20H,4-9,13H2,1-3H3,(H,19,21) |
InChIKey | XJQPQKLURWNAAH-UHFFFAOYSA-N |
SMILES | CC(C)CCCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |