For research use only. Not for therapeutic Use.
Dihydro ferulic acid (Cat.No:R013592) is a derivative of ferulic acid, a naturally occurring compound found in plants. It possesses antioxidant properties and is formed through the reduction of ferulic acid. Dihydro ferulic acid exhibits potential in various health applications due to its ability to scavenge free radicals and support cellular health.
| Catalog Number | R013592 |
| CAS Number | 1135-23-5 |
| Synonyms | 4-Hydroxy-3-methoxybenzenepropanoic Acid; 4-Hydroxy-3-methoxyhydrocinnamic Acid; β-3-Methoxy-4-hydroxyphenylpropionic acid; 3-Methoxyphloretic Acid; Dihydroconiferylic Acid; Hydroferulic Acid; Shorbic Acid; |
| Molecular Formula | C10H12O4 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | Store at +4C |
| IUPAC Name | 3-(4-hydroxy-3-methoxyphenyl)propanoic acid |
| InChI | InChI=1S/C10H12O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2,4,6,11H,3,5H2,1H3,(H,12,13) |
| InChIKey | BOLQJTPHPSDZHR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CCC(=O)O)O |
| Reference | <p> |
