For research use only. Not for therapeutic Use.
Dihydro Uracil-d4（Cat No.:C000161）, is a deuterium-labeled derivative of dihydrouracil. Deuterium-labeled compounds like this are used as internal standards or reference materials in various analytical and biochemical studies, particularly in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. The presence of deuterium atoms in Dihydro Uracil-d4 allows researchers to trace and quantify the compound’s behavior in chemical reactions or metabolic pathways more precisely.
| Catalog Number | C000161 |
| CAS Number | 334473-41-5 |
| Synonyms | 5,6-Dihydro-2,4(1H,3H)-pyrimidinedione-d4; 5,6-Dihydrouracil-d4; NSC 11867-d4 |
| Molecular Formula | C₄H₂D₄N₂O₂ |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | 5,5,6,6-tetradeuterio-1,3-diazinane-2,4-dione |
| InChI | InChI=1S/C4H6N2O2/c7-3-1-2-5-4(8)6-3/h1-2H2,(H2,5,6,7,8)/i1D2,2D2 |
| InChIKey | OIVLITBTBDPEFK-LNLMKGTHSA-N |
| SMILES | C1CNC(=O)NC1=O |
| Reference | Chawla, M., et al.: Nucleic Acids Res 43, 9573 (2015); Jian, Y., et al.: J. Am. Chem. Soc. 137, 3318 (2015); Shaul, Y. D., et al.: Cell 158, 1094 (2014) |
