For research use only. Not for therapeutic Use.
Dihydrobaicalein（Cat No.:I041047）is a flavonoid compound derived from the root of Scutellaria baicalensis, a plant commonly used in traditional medicine. It exhibits various bioactive properties, including antioxidant, anti-inflammatory, and neuroprotective effects. Studies suggest that dihydrobaicalein may help protect against neurodegenerative diseases like Alzheimer’s and Parkinson’s by reducing oxidative stress and inflammation. Additionally, it has potential anticancer activity through the inhibition of cancer cell proliferation and induction of apoptosis. Its ability to modulate multiple signaling pathways makes dihydrobaicalein a promising candidate for therapeutic applications in neurological and metabolic disorders.
| CAS Number | 35683-17-1 |
| Synonyms | 5,6,7-trihydroxy-2-phenyl-2,3-dihydrochromen-4-one |
| Molecular Formula | C15H12O5 |
| Purity | ≥95% |
| IUPAC Name | 5,6,7-trihydroxy-2-phenyl-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C15H12O5/c16-9-6-11(8-4-2-1-3-5-8)20-12-7-10(17)14(18)15(19)13(9)12/h1-5,7,11,17-19H,6H2 |
| InChIKey | GPDJGLOROGNHJD-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(C1=O)C(=C(C(=C2)O)O)O)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
