For research use only. Not for therapeutic Use.
Dihydroberberine is a naturally occurring alkaloid used in pharmaceutical and biochemical research. It is a hydrogenated derivative of berberine, known for its potential therapeutic properties, including antimicrobial, anti-inflammatory, and antidiabetic effects. This compound is essential for studying the pharmacological activities and mechanisms of action of berberine derivatives, ensuring precise and reliable results in advanced drug development and medicinal chemistry research.
| Catalog Number | R014907 |
| CAS Number | 483-15-8 |
| Synonyms | Dihydroberberine; 13,13a-Didehydro-9,10-dimethoxy-2,3-(methylenedioxy)berbine; 7,8-Dihydroberberine; Dihydroberberine; Dihydroumbellatine; NSC 331264 |
| Molecular Formula | C20H19NO4 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | -20°C |
| InChI | InChI=1S/C20H19NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,7-9H,5-6,10-11H2,1-2H3 |
| InChIKey | FZAGOOYMTPGPGF-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C=C3C4=CC5=C(C=C4CCN3C2)OCO5)OC |
