For research use only. Not for therapeutic Use.
Dihydrocapsaicin-d3（Cat No.:S000488） is a deuterated form of dihydrocapsaicin, where three hydrogen atoms are replaced with deuterium. Dihydrocapsaicin is one of the several capsaicinoids found in chili peppers, contributing to their spicy heat. It is chemically similar to capsaicin but slightly less pungent. The deuterium substitution in dihydrocapsaicin-d3 enhances its chemical stability, making it particularly useful for detailed pharmacokinetic and metabolic research. These studies allow for a better understanding of how dihydrocapsaicin is metabolized in the body, facilitating the development of its potential applications in pain relief and anti-inflammatory treatments.
| Catalog Number | S000488 |
| CAS Number | 1330261-21-6 |
| Molecular Formula | C18H26D3NO3 |
| Purity | ≥95% |
| IUPAC Name | N-[[4-hydroxy-3-(trideuteriomethoxy)phenyl]methyl]-8-methylnonanamide |
| InChI | InChI=1S/C18H29NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h10-12,14,20H,4-9,13H2,1-3H3,(H,19,21)/i3D3 |
| InChIKey | XJQPQKLURWNAAH-HPRDVNIFSA-N |
| SMILES | CC(C)CCCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
