For research use only. Not for therapeutic Use.
Dihydroeponemycin（Cat No.:I011768）is a bioactive epoxide compound and irreversible proteasome inhibitor derived from microbial sources, known for its anticancer and anti-angiogenic properties. By inhibiting the proteasome, it disrupts protein degradation, leading to the accumulation of misfolded proteins and induction of apoptosis in cancer cells. Dihydroeponemycin’s action on the ubiquitin-proteasome pathway has garnered attention in cancer research, particularly for targeting tumor cells’ dependency on proteasomal function. Its role in inhibiting cell growth and inducing programmed cell death makes it a promising compound for exploring new cancer therapies and biological pathways.
| Catalog Number | I011768 |
| CAS Number | 126463-64-7 |
| Synonyms | N-[(2S)-3-hydroxy-1-[[(2S)-1-[(2R)-2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]-6-methylheptanamide |
| Molecular Formula | C20H36N2O6 |
| Purity | ≥95% |
| Target | Proteasome |
| Solubility | >15.6mg/mL in DMSO |
| Storage | Store at 2-8°C |
| IUPAC Name | N-[(2S)-3-hydroxy-1-[[(2S)-1-[(2R)-2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]-6-methylheptanamide |
| InChI | InChI=1S/C20H36N2O6/c1-13(2)7-5-6-8-17(25)21-16(10-23)19(27)22-15(9-14(3)4)18(26)20(11-24)12-28-20/h13-16,23-24H,5-12H2,1-4H3,(H,21,25)(H,22,27)/t15-,16-,20+/m0/s1 |
| InChIKey | IUDBVFIQSSOIDB-TWOQFEAHSA-N |
| SMILES | CC(C)CCCCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)[C@]1(CO1)CO |
