For research use only. Not for therapeutic Use.
Dihydrolapachenole is a naturally occurring quinone[1].
| Catalog Number | M209890 |
| CAS Number | 20213-26-7 |
| Synonyms | 6-methoxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromene |
| Molecular Formula | C16H18O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C16H18O2/c1-16(2)9-8-11-10-14(17-3)12-6-4-5-7-13(12)15(11)18-16/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | OZVDAMFCGBFOHR-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C3=CC=CC=C3C(=C2)OC)C |
| Reference | [1]. A. R. Burnett, et al. Naturally occurring quinones. Part XII. Extractives from Tabebuia chrysantha nichols and other bignoniaceae. Journal of the chemical society C: Organic.1968. |
