For research use only. Not for therapeutic Use.
Dihydromaltol（Cat No.:L007714）, is a chemical compound used as a flavor enhancer and antioxidant in the food industry. It is a derivative of maltol, a naturally occurring compound found in various foods and plants, known for its pleasant caramel-like odor and flavor. Dihydromaltol is utilized to enhance the taste and aroma of food products, particularly in confectionery, bakery, and beverage items. Its antioxidant properties also make it valuable for extending the shelf life of certain food products.
| Catalog Number | L007714 |
| CAS Number | 38877-21-3 |
| Molecular Formula | C6H8O3 |
| Purity | ≥95% |
| IUPAC Name | 5-hydroxy-6-methyl-2,3-dihydropyran-4-one |
| InChI | InChI=1S/C6H8O3/c1-4-6(8)5(7)2-3-9-4/h8H,2-3H2,1H3 |
| InChIKey | YTKBKDDTNVNZLX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)CCO1)O |
