For research use only. Not for therapeutic Use.
Dihydromyricetin（Cat No.:I002932）is a natural flavonoid compound extracted from the vine Ampelopsis grossedentata. It is renowned for its potent antioxidant, anti-inflammatory, and hepatoprotective properties. Dihydromyricetin is commonly used to protect the liver from damage caused by alcohol consumption, reducing oxidative stress and enhancing detoxification processes. Additionally, it has shown potential in improving insulin sensitivity and aiding in the management of metabolic disorders. With its multifaceted health benefits and minimal side effects, Dihydromyricetin is a valuable supplement for promoting liver health, combating inflammation, and supporting overall well-being.
| Catalog Number | I002932 |
| CAS Number | 27200-12-0 |
| Synonyms | (2R,3R)-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one |
| Molecular Formula | C15H12O8 |
| Purity | ≥95% |
| IUPAC Name | (2R,3R)-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C15H12O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,14-20,22H/t14-,15+/m0/s1 |
| InChIKey | KJXSIXMJHKAJOD-LSDHHAIUSA-N |
| SMILES | C1=C(C=C(C(=C1O)O)O)C2C(C(=O)C3=C(C=C(C=C3O2)O)O)O |
