For research use only. Not for therapeutic Use.
(-)-Dihydroquinine is a high-purity alkaloid used in advanced pharmaceutical and chemical research. This enantiomer of dihydroquinine is essential for chiral resolution, asymmetric synthesis, and catalysis studies. Known for its optical purity and stability, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision scientific investigations in diverse research applications.
| Catalog Number | R022101 |
| CAS Number | 522-66-7 |
| Synonyms | (8α,9R)-10,11-Dihydro-6’-methoxycinchonan-9-ol; Hydroquinine; 10,11-Dihydroquinine; (-)-10,11-Dihydroquinine; (-)-Hydroquinine; Dihydroquinine; NSC 41799; |
| Molecular Formula | C20H26N2O2 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | -20°C |
| IUPAC Name | (R)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| InChI | InChI=1S/C20H26N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h4-6,8,11,13-14,19-20,23H,3,7,9-10,12H2,1-2H3/t13-,14-,19-,20+/m0/s1 |
| InChIKey | LJOQGZACKSYWCH-WZBLMQSHSA-N |
| SMILES | CCC1CN2CCC1CC2C(C3=C4C=C(C=CC4=NC=C3)OC)O |
