For research use only. Not for therapeutic Use.
Diiodohydroxyquinoline(Cat No.:I005015)is an iodine-containing quinoline derivative used primarily in pharmaceutical research for its potential antimicrobial and antifungal properties. It functions by inhibiting microbial growth through its ability to interfere with cellular processes, including enzyme inhibition and membrane disruption. This compound is valuable in the development of topical treatments for infections caused by resistant microorganisms. Its iodine component enhances its antimicrobial activity, making it an essential tool in studies of infection control. Diiodohydroxyquinoline also has potential applications in pharmaceutical formulations for treating various bacterial and fungal conditions.
Catalog Number | I005015 |
CAS Number | 83-73-8 |
Molecular Formula | C9H5I2NO |
Purity | ≥95% |
Target | Bacterial |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | 5,7-diiodoquinolin-8-ol |
InChI | InChI=1S/C9H5I2NO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H |
InChIKey | UXZFQZANDVDGMM-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=C(C=C2I)I)O)N=C1 |
Reference | <p style=/line-height:25px/> |