For research use only. Not for therapeutic Use.
Diisobutyl phthalate (Cat.No:R039565) is a commonly used plasticizer, primarily added to plastics to increase their flexibility and durability. It’s utilized in various consumer products, such as PVC plastics, adhesives, and coatings.
| CAS Number | 84-69-5 |
| Synonyms | 1,2-Benzenedicarboxylic Acid Bis(2-methylpropyl) Ester; Phthalic Acid Diisobutyl ester; Benzenedicarboxylic Acid Diisobutyl Ester; 2-Methylpropyl Phthalate; Bis(2-methylpropyl) Phthalate; Di(2-methylpropyl) Phthalate; Di(isobutyl) 1,2-benzenedicarbox |
| Molecular Formula | C16H22O4 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | bis(2-methylpropyl) benzene-1,2-dicarboxylate |
| InChI | InChI=1S/C16H22O4/c1-11(2)9-19-15(17)13-7-5-6-8-14(13)16(18)20-10-12(3)4/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | MGWAVDBGNNKXQV-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)C1=CC=CC=C1C(=O)OCC(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
