For research use only. Not for therapeutic Use.
Diisooctyl adipate(Cat No.:M048733), commonly abbreviated as DOA, is an ester formed from the reaction of isooctyl alcohol and adipic acid. It is a colorless, oily liquid known for its low toxicity and excellent properties as a plasticizer. DOA is primarily used to enhance the flexibility and durability of polymeric materials, including PVC and its derivatives. Its effectiveness in lowering the fusion temperature and enhancing the processability of plastics makes it valuable in the production of food packaging films, garden hoses, and other flexible PVC products. Additionally, it serves as a carrier fluid in cosmetics and personal care products.
CAS Number | 1330-86-5 |
Molecular Formula | C22H42O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | bis(6-methylheptyl) hexanedioate |
InChI | InChI=1S/C22H42O4/c1-19(2)13-7-5-11-17-25-21(23)15-9-10-16-22(24)26-18-12-6-8-14-20(3)4/h19-20H,5-18H2,1-4H3 |
InChIKey | CJFLBOQMPJCWLR-UHFFFAOYSA-N |
SMILES | CC(C)CCCCCOC(=O)CCCCC(=O)OCCCCCC(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |