For research use only. Not for therapeutic Use.
Diisopropylidene Acetone (Cat.No:R064088) is a chemical compound used as a versatile building block in organic synthesis. Its structure contains a ketone functional group protected by two isopropylidene groups, making it a valuable intermediate for creating complex molecules with specific properties. It finds wide application in pharmaceutical and fine chemical industries.
CAS Number | 504-20-1 |
Synonyms | Diisobutenyl Ketone; Diisopropylidene Acetone; Foron; NSC 38718; NSC 403517; Phorone; sym-Diisopropylidene Acetone; 2,6-Dimethyl-2,5-heptadien-4-one |
Molecular Formula | C9H14O |
Purity | ≥95% |
Storage | Desiccate at -20°C |
IUPAC Name | 2,6-dimethylhepta-2,5-dien-4-one |
InChI | InChI=1S/C9H14O/c1-7(2)5-9(10)6-8(3)4/h5-6H,1-4H3 |
InChIKey | MTZWHHIREPJPTG-UHFFFAOYSA-N |
SMILES | CC(=CC(=O)C=C(C)C)C |