For research use only. Not for therapeutic Use.
Dilauroyl peroxide (Cat No.:M069682) is an organic peroxide compound used primarily as a polymerization initiator and cross-linking agent in the production of various polymers and plastics, such as polyethylene and polyvinyl chloride (PVC). It serves as a source of free radicals, which initiate polymerization reactions and promote the formation of cross-linked networks in the polymer chains. This enhances the physical properties and stability of the final polymer products. Dilauroyl peroxide’s ability to facilitate these reactions makes it a valuable ingredient in the plastics and rubber industries, contributing to the production of durable and versatile materials used in countless applications.
CAS Number | 105-74-8 |
Molecular Formula | (C11H23CO)2O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | dodecanoyl dodecaneperoxoate |
InChI | InChI=1S/C24H46O4/c1-3-5-7-9-11-13-15-17-19-21-23(25)27-28-24(26)22-20-18-16-14-12-10-8-6-4-2/h3-22H2,1-2H3 |
InChIKey | YIVJZNGAASQVEM-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC |