For research use only. Not for therapeutic Use.
Diligustilide(CAT: R064471) is a natural compound found in certain medicinal plants, including Ligusticum chuanxiong (also known as Chuanxiong or Szechuan Lovage). Its mode of action involves being a phthalide derivative with potential pharmacological properties. Diligustilide has been studied for its potential effects on the cardiovascular system, including vasodilation and blood pressure regulation. Additionally, it exhibits anti-inflammatory and neuroprotective effects. Due to its interesting bioactivity, Diligustilide is of interest in traditional medicine and herbal remedies.
CAS Number | 88182-33-6 |
Molecular Formula | C24H28O4 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (1S,2S,6Z,10S,11S,16Z)-6,16-di(butylidene)-5,15-dioxapentacyclo[9.5.2.01,13.02,10.03,7]octadeca-3(7),12-diene-4,14-dione |
InChI | InChI=1S/C24H28O4/c1-3-5-7-18-16-10-9-15-14-11-12-24(21(15)20(16)23(26)27-18)17(13-14)22(25)28-19(24)8-6-4-2/h7-8,13-15,21H,3-6,9-12H2,1-2H3/b18-7-,19-8-/t14-,15+,21-,24+/m1/s1 |
InChIKey | UBBRXVRQZJSDAK-ZJHGLIIDSA-N |
SMILES | CCCC=C1C2=C(C3C(CC2)C4CCC35C(=C4)C(=O)OC5=CCCC)C(=O)O1 |