For research use only. Not for therapeutic Use.
<p style=/line-height:25px/>Diloxanide furoate (Cat.No:I003374) is a luminal amebicide used in the treatment of Amebiasis, is considered the luminal agent of choice for mild intestinal amebiasis or asymptomatic cyst carriers.</p>
| Catalog Number | I003374 |
| CAS Number | 3736-81-0 |
| Molecular Formula | C14H11Cl2NO4 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | [4-[(2,2-dichloroacetyl)-methylamino]phenyl] furan-2-carboxylate |
| InChI | InChI=1S/C14H11Cl2NO4/c1-17(13(18)12(15)16)9-4-6-10(7-5-9)21-14(19)11-3-2-8-20-11/h2-8,12H,1H3 |
| InChIKey | BDYYDXJSHYEDGB-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)OC(=O)C2=CC=CO2)C(=O)C(Cl)Cl |
| Reference | <p style=/line-height:25px/> |
