For research use only. Not for therapeutic Use.
DIMBOA(Cat No.:R020859) refers to 2,4-dihydroxy-7-methoxy-1,4-benzoxazin-3-one. It is a natural compound belonging to the class of benzoxazinoids and is primarily found in various cereal crops such as maize (corn). Its mode of action and pharmacological effects involve its role as a defensive phytochemical, acting as a natural herbivore deterrent and potentially inhibiting the growth of certain insects and pathogens. DIMBOA contributes to the plant’s defense mechanism against pests and stressors. Its applications extend to plant protection and crop improvement strategies, where it can help enhance the resistance of crops to various biotic stresses.
CAS Number | 15893-52-4 |
Synonyms | (±)-2,4-Dihydroxy-7-methoxy-2H-1,4-benzoxazin-3(4H)-one; (±)-DIMBOA; 2,3-Dihydro-2,4-dihydroxy-7-methoxy-4H-1,4-benzoxazin-3-one; 2,4-Dihydroxy-3-keto-7-methoxy-1,4-benzoxazine; 2,4-Dihydroxy-7-methoxy-1,4-(2H)-benzoxazin-3-one; 2,4-Dihydroxy-7-metho |
Molecular Formula | C9H9NO5 |
Purity | ≥95% |
Target | Fungal |
Storage | -20°C |
IUPAC Name | 2,4-dihydroxy-7-methoxy-1,4-benzoxazin-3-one |
InChI | InChI=1S/C9H9NO5/c1-14-5-2-3-6-7(4-5)15-9(12)8(11)10(6)13/h2-4,9,12-13H,1H3 |
InChIKey | GDNZNIJPBQATCZ-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(C=C1)N(C(=O)C(O2)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |