For research use only. Not for therapeutic Use.
Dimethisoquin Hydrochloride is a high-purity pharmaceutical compound used in advanced biochemical research. This local anesthetic is essential for studying its analgesic properties and interactions with cellular receptors. Its precise composition ensures reliable and reproducible results, making it indispensable for drug development and pain management research. Ideal for experimental setups, Dimethisoquin Hydrochloride enhances research accuracy and efficacy in various scientific investigations.
Catalog Number | R024056 |
CAS Number | 2773-92-4 |
Synonyms | 2-[(3-Butyl-1-isoquinolinyl)oxy]-N,N-dimethyl-ethanamine Monohydrochloride; 3-Butyl-1-[2-(dimethylamino)ethoxy]-isoquinoline Hydrochloride; 3-Butyl-1-[2-(dimethylamino)ethoxy]-isoquinoline Monohydrochloride; 1-(β-Dimethylaminoethoxy)-3-n-butylisoqui |
Molecular Formula | C17H25ClN2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(3-butylisoquinolin-1-yl)oxy-N,N-dimethylethanamine;hydrochloride |
InChI | InChI=1S/C17H24N2O.ClH/c1-4-5-9-15-13-14-8-6-7-10-16(14)17(18-15)20-12-11-19(2)3;/h6-8,10,13H,4-5,9,11-12H2,1-3H3;1H |
InChIKey | SEYCAKMZVYADRS-UHFFFAOYSA-N |
SMILES | CCCCC1=CC2=CC=CC=C2C(=N1)OCCN(C)C.Cl |