For research use only. Not for therapeutic Use.
Dimethocaine is a local anesthetic and stimulant used in pharmaceutical and neurological research. It is studied for its effects on the central nervous system and its potential therapeutic applications. This compound is essential for investigating anesthetic mechanisms, developing pain management solutions, and exploring stimulant properties, ensuring precise and reliable results in advanced scientific research.
| Catalog Number | R015970 |
| CAS Number | 94-15-5 |
| Synonyms | 2-[(Diethylamino)methyl]-2-methyl-1-propanol 1-(4-Aminobenzoate); 3-(Diethylamino)-2,2-dimethyl-1-propanol 4-Aminobenzoate; p-3-(Diethylamino)-2,2-dimethyl-1-propanol Amino Benzene; 3-(Diethylamino)-2,2-dimethyl-1-Propanol p-Aminobenzoate; Larocaine; |
| Molecular Formula | C16H26N2O2 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | [3-(diethylamino)-2,2-dimethylpropyl] 4-aminobenzoate |
| InChI | InChI=1S/C16H26N2O2/c1-5-18(6-2)11-16(3,4)12-20-15(19)13-7-9-14(17)10-8-13/h7-10H,5-6,11-12,17H2,1-4H3 |
| InChIKey | OWQIUQKMMPDHQQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(C)(C)COC(=O)C1=CC=C(C=C1)N |
