Home
>
Chemical Reagents>Heterocyclic Building Blocks> dimethyl 1-methyl-1H-pyrazole-3,5-dicarboxylate
For research use only. Not for therapeutic Use.
Dimethyl 1-methyl-1H-pyrazole-3,5-dicarboxylate(Cat No.:L020540)is a multifunctional compound featuring a pyrazole ring, a key structure in medicinal chemistry due to its relevance in drug design. This compound is characterized by two ester groups at the 3 and 5 positions, enhancing its solubility and reactivity, making it suitable for various synthetic applications. The methyl group at the 1 position of the pyrazole ring contributes to its chemical stability and electronic properties, facilitating its use in synthesizing more complex molecules. It serves as a crucial intermediate in pharmaceutical research, particularly in creating novel therapeutic agents.
CAS Number | 33146-99-5 |
Molecular Formula | C8H10N2O4 |
Purity | ≥95% |
IUPAC Name | dimethyl 1-methylpyrazole-3,5-dicarboxylate |
InChI | InChI=1S/C8H10N2O4/c1-10-6(8(12)14-3)4-5(9-10)7(11)13-2/h4H,1-3H3 |
InChIKey | WGTJNBANTMXQHD-UHFFFAOYSA-N |
SMILES | CN1C(=CC(=N1)C(=O)OC)C(=O)OC |