Home
>
Chemical Reagents>Organic Building Blocks>
>
Dimethyl 2'-hydroxy-5'-(4-(methoxycarbonyl)phenyl)-[1,1':3',1''-terphenyl]-4,4''-dicarboxylate
For research use only. Not for therapeutic Use.
Dimethyl 2′-hydroxy-5′-(4-(methoxycarbonyl)phenyl)-[1,1′:3′,1”-terphenyl]-4,4”-dicarboxylate (Cat.No:L003678) is a significant chemical compound in organic synthesis. Its unique structure, characterized by a terphenyl core, lends itself to various applications, particularly in the development of advanced materials. This compound is a crucial building block for the preparation of specialized polymers and functional molecules, highlighting its importance in contemporary chemical research and materials science.
Catalog Number | L003678 |
CAS Number | 1353118-72-5 |
Molecular Formula | C30H24O7 |
Purity | ≥95% |
IUPAC Name | methyl 4-[4-hydroxy-3,5-bis(4-methoxycarbonylphenyl)phenyl]benzoate |
InChI | InChI=1S/C30H24O7/c1-35-28(32)21-10-4-18(5-11-21)24-16-25(19-6-12-22(13-7-19)29(33)36-2)27(31)26(17-24)20-8-14-23(15-9-20)30(34)37-3/h4-17,31H,1-3H3 |
InChIKey | UXYYAXKYDFEAEF-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC=C(C=C1)C2=CC(=C(C(=C2)C3=CC=C(C=C3)C(=O)OC)O)C4=CC=C(C=C4)C(=O)OC |