For research use only. Not for therapeutic Use.
Dimethyl 2-ketoglutarate (Cat No.:R005989) is an organic compound used in biochemical and chemical research. It is a derivative of 2-ketoglutaconic acid, an intermediate in the citric acid cycle (Krebs cycle) involved in cellular energy production. Dimethyl 2-ketoglutarate is used to study metabolic pathways, enzyme reactions, and other biochemical processes in the laboratory. Its structural similarity to natural metabolites allows researchers to investigate cellular mechanisms and metabolic pathways.
| Catalog Number | R005989 |
| CAS Number | 13192-04-6 |
| Synonyms | α-Ketoglutaric Acid Dimethyl Ester; Dimethyl 2-Oxopentanedioate; 2-Oxo-pentanedioic Acid 1,5-Dimethyl Ester; |
| Molecular Formula | C7H10O5 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | dimethyl 2-oxopentanedioate |
| InChI | InChI=1S/C7H10O5/c1-11-6(9)4-3-5(8)7(10)12-2/h3-4H2,1-2H3 |
| InChIKey | TXIXSLPEABAEHP-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(=O)C(=O)OC |
