For research use only. Not for therapeutic Use.
Dimethyl 2,2′-thiobisacetate(CAT: M088701) is an organic compound featuring two acetate groups linked by a sulfur (thio) bridge, commonly used as an intermediate in organic synthesis. This thioester derivative, with two methyl ester groups, is valuable for constructing sulfur-containing molecules in pharmaceutical and chemical research. The sulfur bridge imparts unique reactivity, making it useful in the synthesis of sulfur-based drugs, agrochemicals, and specialty chemicals. Dimethyl 2,2′-thiobisacetate can be employed in various reactions, including nucleophilic substitution and condensation, to create complex compounds for applications in medicinal chemistry and materials science.
CAS Number | 16002-29-2 |
Molecular Formula | C6H10O4S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl 2-(2-methoxy-2-oxoethyl)sulfanylacetate |
InChI | InChI=1S/C6H10O4S/c1-9-5(7)3-11-4-6(8)10-2/h3-4H2,1-2H3 |
InChIKey | ZQUQLLPRRJVUES-UHFFFAOYSA-N |
SMILES | COC(=O)CSCC(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |