For research use only. Not for therapeutic Use.
Dimethyl 2,5-dibromoisophthalate(Cat No.:L032024)is a valuable intermediate in organic synthesis, particularly in the production of advanced polymers, pharmaceuticals, and specialty chemicals. The presence of two bromine atoms on the isophthalate core makes it highly reactive, allowing for versatile chemical transformations. It is commonly used in the synthesis of flame retardants, liquid crystals, and other materials requiring precise molecular modifications. Researchers and chemists rely on this high-purity compound for creating complex molecules with specific functional properties, supporting innovation in materials science and pharmaceutical development.
CAS Number | 1337958-87-8 |
Molecular Formula | C10H8Br2O4 |
Purity | ≥95% |
IUPAC Name | dimethyl 2,5-dibromobenzene-1,3-dicarboxylate |
InChI | InChI=1S/C10H8Br2O4/c1-15-9(13)6-3-5(11)4-7(8(6)12)10(14)16-2/h3-4H,1-2H3 |
InChIKey | GCPAOHQBVHGERO-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=CC(=C1Br)C(=O)OC)Br |