For research use only. Not for therapeutic Use.
Dimethyl 4-aminophthalate is an aromatic ester widely used in organic synthesis and pharmaceutical research. Its primary amine group at the 4-position allows for easy chemical modifications, making it a valuable intermediate in the preparation of dyes, polymers, and biologically active compounds. This compound is also utilized in the development of fluorescent probes and materials. Due to its versatile reactivity, Dimethyl 4-aminophthalate plays a crucial role in advancing the synthesis of novel molecules for various applications.
CAS Number | 51832-31-6 |
Molecular Formula | C10H11NO4 |
Purity | ≥95% |
IUPAC Name | dimethyl 4-aminobenzene-1,2-dicarboxylate |
InChI | InChI=1S/C10H11NO4/c1-14-9(12)7-4-3-6(11)5-8(7)10(13)15-2/h3-5H,11H2,1-2H3 |
InChIKey | NTBHQNDXAJXRPU-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=C(C=C1)N)C(=O)OC |