For research use only. Not for therapeutic Use.
Dimethyl 5-bromo-2-iodoisophthalate (Cat.No:L003556) is a pivotal compound in organic synthesis. Its unique structure and halogen substituents make it a versatile building block for the preparation of complex molecules. This compound is widely utilized in pharmaceutical research, particularly in the development of innovative drug candidates.
CAS Number | 1428236-23-0 |
Molecular Formula | C10H8BrIO4 |
Purity | ≥95% |
IUPAC Name | dimethyl 5-bromo-2-iodobenzene-1,3-dicarboxylate |
InChI | InChI=1S/C10H8BrIO4/c1-15-9(13)6-3-5(11)4-7(8(6)12)10(14)16-2/h3-4H,1-2H3 |
InChIKey | ZDTIMZRONIOKRH-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC(=CC(=C1I)C(=O)OC)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |