For research use only. Not for therapeutic Use.
Dimethyl(acetylacetonate)gold(III)(Cat No.:M051521), often abbreviated as Me2Au(acac), is a coordination complex where gold is bonded to a dimethyl group and an acetylacetonate ligand. This organogold compound is characterized by its vibrant yellow color and is used primarily in chemical research and material science. It serves as a precursor for the synthesis of other gold-based compounds and materials, playing a crucial role in the development of catalysts and nanotechnology applications. Its ability to form stable complexes is also explored in medicinal chemistry for potential therapeutic and diagnostic applications involving gold.
CAS Number | 14951-50-9 |
Synonyms | DIMETHYL(ACETYLACETONATE)GOLD(III); Dimethyl(acetylacetonate)gold(III); Tris-(2,4-pentanedionato)-dimethylgold; dimethylgold(III) acetylacetonate |
Molecular Formula | C7H14AuO2-2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | carbanide;gold;(E)-4-hydroxypent-3-en-2-one |
InChI | InChI=1S/C5H8O2.2CH3.Au/c1-4(6)3-5(2)7;;;/h3,6H,1-2H3;2*1H3;/q;2*-1;/b4-3+;;; |
InChIKey | OODGPXRGNOXCBP-FHJHGPAASA-N |
SMILES | [CH3-].[CH3-].CC(=CC(=O)C)O.[Au] |