For research use only. Not for therapeutic Use.
Dimethyl acetylenedicarboxylate (Cat.No:R044766) is a versatile chemical compound used in organic synthesis. With two carboxylate groups and a triple bond, it participates in various reactions, like Diels-Alder and Wittig reactions, to form diverse compounds. Its unique structure makes it valuable for creating complex molecules in pharmaceutical and agrochemical research.
CAS Number | 762-42-5 |
Synonyms | 2-Butynedioic Acid 1,4-Dimethyl Ester; 2-Butynedioic Acid Dimethyl Ester; Acetylenedicarboxylic Acid Dimethyl Ester; 1,2-Bis(methoxycarbonyl)acetylene; 1,2-Bis(methoxycarbonyl)ethyne; Bis(carbomethoxy)acetylene; Bis(methoxycarbonyl)acetylene; Butyned |
Molecular Formula | C6H6O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | dimethyl but-2-ynedioate |
InChI | InChI=1S/C6H6O4/c1-9-5(7)3-4-6(8)10-2/h1-2H3 |
InChIKey | VHILMKFSCRWWIJ-UHFFFAOYSA-N |
SMILES | COC(=O)C#CC(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |