For research use only. Not for therapeutic Use.
Dimethyl adipate-d8(Cat No.:I041499)is a deuterated version of dimethyl adipate, where eight hydrogen atoms are replaced by deuterium atoms. This isotopic modification enhances its utility in analytical techniques like mass spectrometry, allowing for precise tracking and quantification in chemical reactions. Dimethyl adipate is commonly used in the production of polyesters, plastics, and as a plasticizer, while the deuterated form helps in studying reaction mechanisms, metabolic pathways, and compound transformations involving adipic acid derivatives. The d8 version provides a reliable internal standard in various experimental and industrial applications.
CAS Number | 52089-64-2 |
Synonyms | dimethyl 2,2,3,3,4,4,5,5-octadeuteriohexanedioate |
Molecular Formula | C8H6D8O4 |
Purity | ≥95% |
IUPAC Name | dimethyl 2,2,3,3,4,4,5,5-octadeuteriohexanedioate |
InChI | InChI=1S/C8H14O4/c1-11-7(9)5-3-4-6-8(10)12-2/h3-6H2,1-2H3/i3D2,4D2,5D2,6D2 |
InChIKey | UDSFAEKRVUSQDD-SQUIKQQTSA-N |
SMILES | [2H]C([2H])(C(=O)OC)C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OC |