For research use only. Not for therapeutic Use.
Dimethyl Allylmalonate is an important compound in organic chemistry, often utilized as a versatile intermediate in the synthesis of pharmaceuticals and agrochemicals. With its malonate structure and allyl group, it enables various reactions, including alkylation and cyclization, facilitating the creation of complex molecular frameworks. This compound’s ability to participate in both nucleophilic and electrophilic reactions makes it valuable for drug development and synthetic applications. Dimethyl Allylmalonate plays a crucial role in advancing research in medicinal chemistry and related fields.
CAS Number | 40637-56-7 |
Synonyms | Dimethyl 2-Allylmalonate; Dimethyl 2-(Prop-2-enyl)propane-1,3-dioate; 4,4-Bis(carboxymethoxy)-1-butene; Dimethyl 2-(2-propenyl)malonate; 2-propenylpropanedioic Acid Dimethyl Ester |
Molecular Formula | C8H12O4 |
Purity | ≥95% |
Storage | Store at +4 ℃ |
IUPAC Name | dimethyl 2-prop-2-enylpropanedioate |
InChI | InChI=1S/C8H12O4/c1-4-5-6(7(9)11-2)8(10)12-3/h4,6H,1,5H2,2-3H3 |
InChIKey | VZNFVLWVVHHMBG-UHFFFAOYSA-N |
SMILES | COC(=O)C(CC=C)C(=O)OC |