For research use only. Not for therapeutic Use.
Dimethyl carbonate (DMC) is a versatile chemical compound. It is a colorless, flammable liquid with a mild, pleasant odor. DMC is used as a solvent, fuel additive, and reagent in organic synthesis. Its applications include polycarbonate production, methylation, and carbonylation reactions, making it an environmentally friendly alternative to traditional solvents.
| CAS Number | 616-38-6 |
| Synonyms | AK 100; AK 100 (carbonate); Dimethyl carbonate; Methyl carbonate; Methyl carbonate ((MeO)2CO); NSC 9371; |
| Molecular Formula | C3H6O3 |
| Purity | ≥95% |
| Storage | Desiccate at 4°C |
| IUPAC Name | dimethyl carbonate |
| InChI | InChI=1S/C3H6O3/c1-5-3(4)6-2/h1-2H3 |
| InChIKey | IEJIGPNLZYLLBP-UHFFFAOYSA-N |
| SMILES | COC(=O)OC |
