For research use only. Not for therapeutic Use.
Dimethylurea/citric acid is a highly efficient deep eutectic solvent (DES). Dimethylurea/citric acid can be used as a catalyst and a green reaction medium for the synthesis of bis(indolyl)methanes, quinolines and aryl-4, 5-diphenyl-1H-imidazoles.
| Catalog Number | I044780 |
| CAS Number | 53798-97-3 |
| Synonyms | 3-hydroxy-5-methoxy-3-methoxycarbonyl-5-oxopentanoic acid |
| Molecular Formula | C8H12O7 |
| Purity | ≥95% |
| InChI | InChI=1S/C8H12O7/c1-14-6(11)4-8(13,3-5(9)10)7(12)15-2/h13H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | OMIHCBSQSYMFDP-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(CC(=O)O)(C(=O)OC)O |
| Reference | [1]. BEHNAZ BAFTI & HOJATOLLAH KHABAZZADEH, et al. Dimethylurea/citric acid as a highly efficient deep eutectic solvent for the multi-component reactions. Journal of Chemical Sciences volume 126, pages881–887 |
