For research use only. Not for therapeutic Use.
Dimethyl-d6 Trisulfide is a deuterated form of dimethyl trisulfide, featuring six deuterium atoms. This compound is used in chemical and analytical research to enhance the precision of studies involving sulfur-containing compounds. Dimethyl trisulfide, known for its strong odor, is a sulfur-containing compound used in flavor and fragrance industries, as well as in studies related to environmental chemistry and biochemistry. The deuterium labeling allows for detailed analysis using techniques like NMR and mass spectrometry, facilitating investigations into its reaction mechanisms, metabolic pathways, and interactions in various chemical and biological systems.
Catalog Number | R052418 |
CAS Number | 58069-93-5 |
Synonyms | Di(methyl-d3) Trisulfide; |
Molecular Formula | C2H6S3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | trideuterio-(trideuteriomethyltrisulfanyl)methane |
InChI | InChI=1S/C2H6S3/c1-3-5-4-2/h1-2H3/i1D3,2D3 |
InChIKey | YWHLKYXPLRWGSE-WFGJKAKNSA-N |
SMILES | [2H]C([2H])([2H])SSSC([2H])([2H])[2H] |