Dimethyl Phthalate-13C2（Cat No.:R052290） is a high-purity isotopically labeled compound essential for advanced pharmaceutical and environmental research. This version of Dimethyl Phthalate, featuring two carbon-13 atoms, is crucial for studies on phthalate metabolism, environmental pollutant tracking, and toxicological assessments. Its stable isotope labeling ensures precise and reliable analytical results. With enhanced stability and consistency, it is suitable for various experimental setups. Ideal for analytical chemistry and environmental monitoring, Dimethyl Phthalate-13C2 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | R052290 |
| CAS Number | 1346598-73-9 |
| Synonyms | 1,2-Benzenedicarboxylic Acid 1,2-Dimethyl-13C2 Ester; Avolin-13C2; DMF-13C2; DMP-13C2; Dimethyl-13C2 1,2-Benzenedicarboxylate; Dimethyl-13C2 o-Phthalate; Dimethyl-13C2 Phthalate; Fermine-13C2; Mipax-13C2; NSC 15398-13C2; NTM-13C2; Palatinol M-13C2; R |
| Molecular Formula | C10H10O4 |
| Purity | 95% |
| Storage | Desiccate at RT |
| IUPAC Name | di(113C)methyl benzene-1,2-dicarboxylate |
| InChI | InChI=1S/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3/i1+1,2+1 |
| InChIKey | NIQCNGHVCWTJSM-ZDOIIHCHSA-N |
| SMILES | [13CH3]OC(=O)C1=CC=CC=C1C(=O)O[13CH3] |
