For research use only. Not for therapeutic Use.
Dimethyl Propargylmalonate(Cat No.:L007041), is a chemical compound featuring two methyl groups and a propargyl group attached to a malonate backbone. It is widely used in organic synthesis as a versatile reagent. This compound is valuable in various chemical reactions, including cycloadditions and Sonogashira couplings, due to its ability to introduce both alkynyl and ester functionalities into organic molecules. Dimethyl propargyl malonate serves as a key building block in the synthesis of complex organic compounds, including pharmaceuticals and agrochemicals. Its unique reactivity and structural features make it significant in the development of novel molecules in the field of organic chemistry.
CAS Number | 95124-07-5 |
Molecular Formula | C8H10O4 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | dimethyl 2-prop-2-ynylpropanedioate |
InChI | InChI=1S/C8H10O4/c1-4-5-6(7(9)11-2)8(10)12-3/h1,6H,5H2,2-3H3 |
InChIKey | PWQAXFWWMXTVFT-UHFFFAOYSA-N |
SMILES | COC(=O)C(CC#C)C(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |