For research use only. Not for therapeutic Use.
Dimethyl sulfoxide-d6 is a deuterated form of dimethyl sulfoxide (DMSO), a versatile solvent widely used in chemical, pharmaceutical, and biological research. The six deuterium atoms replace hydrogen atoms in the DMSO molecule, providing a stable isotopic label for enhanced accuracy in NMR spectroscopy and mass spectrometry. This labeled solvent is useful for studying reaction mechanisms, solubility properties, and the behavior of compounds in various chemical processes. Its applications include tracking isotopic effects in chemical reactions, improving spectral resolution, and understanding solvent interactions in biological systems and organic synthesis.
CAS Number | 2206-27-1 |
Synonyms | Sulfinylbismethane-d3; (Methyl Sulfoxide)-d6; Bis(trideuteriomethyl) Sulfoxide; Bis(trideuteromethyl) Sulfoxide; DMSO-d6; Deuterated-DMSO; Di(methyl-d3) Sulfoxide; Dimethyl-d6 Sulfoxide; Hexadeuteriodimethyl Sulfoxide; Perdeuterated Dimethyl Sulfoxid |
Molecular Formula | C2H6OS |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | trideuterio(trideuteriomethylsulfinyl)methane |
InChI | InChI=1S/C2H6OS/c1-4(2)3/h1-2H3/i1D3,2D3 |
InChIKey | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |