For research use only. Not for therapeutic Use.
Dimethyl Sulfoxide (Cat No.:R024062) is a highly polar, organic solvent known for its exceptional ability to dissolve a wide range of compounds, making it invaluable in chemical, pharmaceutical, and biological research. DMSO is commonly used as a solvent in drug development, cell cryopreservation, and as a vehicle for drug delivery due to its ability to penetrate biological membranes. Additionally, it has anti-inflammatory and analgesic properties, leading to its limited therapeutic use. Its versatility and low toxicity profile make DMSO an essential tool in laboratory environments and scientific studies.
| Catalog Number | R024062 |
| CAS Number | 67-68-5 |
| Synonyms | Sulfinylbismethane; Methyl Sulfoxide; DMS 70; DMS 90; DMSO; DMSO Evol; Demasorb; Demavet; Demeso; Demsodrox; Dimethyl sulfoxide; Dimethyl Sulphoxide; Dimethylsulfoxide; Dimexide; Dimexidum; Dipirartril-tropico; Dolicur; Domoso; Dromisol; Durasorb; Ga |
| Molecular Formula | C2H6OS |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | Desiccate at RT |
| IUPAC Name | methylsulfinylmethane |
| InChI | InChI=1S/C2H6OS/c1-4(2)3/h1-2H3 |
| InChIKey | IAZDPXIOMUYVGZ-UHFFFAOYSA-N |
| SMILES | CS(=O)C |
